C13H21N3O3 — CID 142601016
(2S)-N-[(3S)-4-oxopent-1-yn-3-yl]-2-[2-(propanoylamino)ethylamino]propanamide (PubChem CID 142601016) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-N-[(3S)-4-oxopent-1-yn-3-yl]-2-[2-(propanoylamino)ethylamino]propanamide.
| Compound Name | (2S)-N-[(3S)-4-oxopent-1-yn-3-yl]-2-[2-(propanoylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 142601016 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (2S)-N-[(3S)-4-oxopent-1-yn-3-yl]-2-[2-(propanoylamino)ethylamino]propanamide |
| SMILES | C#C[C@H](NC(=O)[C@H](C)NCCNC(=O)CC)C(C)=O |
| InChI | InChI=1S/C13H21N3O3/c1-5-11(10(4)17)16-13(19)9(3)14-7-8-15-12(18)6-2/h1,9,11,14H,6-8H2,2-4H3,(H,15,18)(H,16,19)/t9-,11-/m0/s1 |
| InChIKey | OWHCNLATIGBSRC-ONGXEEELSA-N |
| XLogP | -0.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|