C22H21N — CID 142604585
6-[(E)-but-2-en-2-yl]-9-phenyl-2,3-dihydrocarbazole (PubChem CID 142604585) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-[(E)-but-2-en-2-yl]-9-phenyl-2,3-dihydrocarbazole.
| Compound Name | 6-[(E)-but-2-en-2-yl]-9-phenyl-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 142604585 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 6-[(E)-but-2-en-2-yl]-9-phenyl-2,3-dihydrocarbazole |
| SMILES | C/C=C(\C)c1ccc2c(c1)c1c(n2-c2ccccc2)=CCCC=1 |
| InChI | InChI=1S/C22H21N/c1-3-16(2)17-13-14-22-20(15-17)19-11-7-8-12-21(19)23(22)18-9-5-4-6-10-18/h3-6,9-15H,7-8H2,1-2H3/b16-3+ |
| InChIKey | QKNKRJHHHGMKBR-HQYXKAPLSA-N |
| XLogP | 4.41 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |