C17H26N2O2S — CID 142605352
ethyl 2-methyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate;heptane (PubChem CID 142605352) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is ethyl 2-methyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate;heptane.
| Compound Name | ethyl 2-methyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate;heptane |
|---|---|
| PubChem CID | 142605352 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | ethyl 2-methyl-[1,3]thiazolo[4,5-b]pyridine-6-carboxylate;heptane |
| SMILES | CCCCCCC.CCOC(=O)c1cnc2nc(C)sc2c1 |
| InChI | InChI=1S/C10H10N2O2S.C7H16/c1-3-14-10(13)7-4-8-9(11-5-7)12-6(2)15-8;1-3-5-7-6-4-2/h4-5H,3H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | NLLKPERLVCXQRF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|