C38H78N6O6 — CID 142609428
ethane;1,3,5-tris[3-(dibutylamino)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 142609428) has the molecular formula C38H78N6O6 and a molecular weight of 715.08 g/mol. Its IUPAC name is ethane;1,3,5-tris[3-(dibutylamino)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | ethane;1,3,5-tris[3-(dibutylamino)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142609428 |
| Molecular Formula | C38H78N6O6 |
| Molecular Weight | 715.08 g/mol |
| Exact Mass | 714.60 |
| IUPAC Name | ethane;1,3,5-tris[3-(dibutylamino)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC.CCCCN(CCCC)CC(O)Cn1c(=O)n(CC(O)CN(CCCC)CCCC)c(=O)n(CC(O)CN(CCCC)CCCC)c1=O |
| InChI | InChI=1S/C36H72N6O6.C2H6/c1-7-13-19-37(20-14-8-2)25-31(43)28-40-34(46)41(29-32(44)26-38(21-15-9-3)22-16-10-4)36(48)42(35(40)47)30-33(45)27-39(23-17-11-5)24-18-12-6;1-2/h31-33,43-45H,7-30H2,1-6H3;1-2H3 |
| InChIKey | DYZGJGVRSJWDFI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |