C23H31FN4O — CID 142610968
[4-fluoro-4-[2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethyl]cyclohexyl]-piperidin-1-ylmethanone (PubChem CID 142610968) has the molecular formula C23H31FN4O and a molecular weight of 398.53 g/mol. Its IUPAC name is [4-fluoro-4-[2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethyl]cyclohexyl]-piperidin-1-ylmethanone.
| Compound Name | [4-fluoro-4-[2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethyl]cyclohexyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 142610968 |
| Molecular Formula | C23H31FN4O |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [4-fluoro-4-[2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethyl]cyclohexyl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCC(F)(CCC2C3=C(CCC=N3)c3cncn32)CC1)N1CCCCC1 |
| InChI | InChI=1S/C23H31FN4O/c24-23(9-6-17(7-10-23)22(29)27-13-2-1-3-14-27)11-8-19-21-18(5-4-12-26-21)20-15-25-16-28(19)20/h12,15-17,19H,1-11,13-14H2 |
| InChIKey | MHDJDMWWSFDODW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |