C18H22FN3 — CID 142610979
7-[2-(1-fluorocyclohexyl)ethyl]-12-methyl-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene (PubChem CID 142610979) has the molecular formula C18H22FN3 and a molecular weight of 299.39 g/mol. Its IUPAC name is 7-[2-(1-fluorocyclohexyl)ethyl]-12-methyl-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene.
| Compound Name | 7-[2-(1-fluorocyclohexyl)ethyl]-12-methyl-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
|---|---|
| PubChem CID | 142610979 |
| Molecular Formula | C18H22FN3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 7-[2-(1-fluorocyclohexyl)ethyl]-12-methyl-4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,8,10-pentaene |
| SMILES | Cc1ccnc2c1-c1cncn1C2CCC1(F)CCCCC1 |
| InChI | InChI=1S/C18H22FN3/c1-13-6-10-21-17-14(22-12-20-11-15(22)16(13)17)5-9-18(19)7-3-2-4-8-18/h6,10-12,14H,2-5,7-9H2,1H3 |
| InChIKey | NQDOGJXWQHAKDL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |