C31H41FN2O2Si — CID 131746665
tert-butyl-[4-fluoro-4-[2-(9-phenylmethoxy-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]oxy-dimethylsilane (PubChem CID 131746665) has the molecular formula C31H41FN2O2Si and a molecular weight of 520.77 g/mol. Its IUPAC name is tert-butyl-[4-fluoro-4-[2-(9-phenylmethoxy-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[4-fluoro-4-[2-(9-phenylmethoxy-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 131746665 |
| Molecular Formula | C31H41FN2O2Si |
| Molecular Weight | 520.77 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | tert-butyl-[4-fluoro-4-[2-(9-phenylmethoxy-5H-imidazo[5,1-a]isoindol-5-yl)ethyl]cyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(F)(CCC2c3cccc(OCc4ccccc4)c3-c3cncn32)CC1 |
| InChI | InChI=1S/C31H41FN2O2Si/c1-30(2,3)37(4,5)36-24-14-17-31(32,18-15-24)19-16-26-25-12-9-13-28(29(25)27-20-33-22-34(26)27)35-21-23-10-7-6-8-11-23/h6-13,20,22,24,26H,14-19,21H2,1-5H3 |
| InChIKey | ZKYVQBHWIKIMLH-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.77 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|