C22H27N3OSi — CID 154593057
tert-butyl-[[6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-pyridinyl]methoxy]-dimethylsilane (PubChem CID 154593057) has the molecular formula C22H27N3OSi and a molecular weight of 377.56 g/mol. Its IUPAC name is tert-butyl-[[6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-pyridinyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-pyridinyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 154593057 |
| Molecular Formula | C22H27N3OSi |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | tert-butyl-[[6-(5H-imidazo[5,1-a]isoindol-5-yl)-2-pyridinyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(C2c3ccccc3-c3cncn32)n1 |
| InChI | InChI=1S/C22H27N3OSi/c1-22(2,3)27(4,5)26-14-16-9-8-12-19(24-16)21-18-11-7-6-10-17(18)20-13-23-15-25(20)21/h6-13,15,21H,14H2,1-5H3 |
| InChIKey | NFECVARYOLLURF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|