C16H12N2O6S — CID 142611743
(5Z)-3-(3-hydroxy-4,5-dimethylphenyl)-5-[(5-nitrofuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 142611743) has the molecular formula C16H12N2O6S and a molecular weight of 360.35 g/mol. Its IUPAC name is (5Z)-3-(3-hydroxy-4,5-dimethylphenyl)-5-[(5-nitrofuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3-hydroxy-4,5-dimethylphenyl)-5-[(5-nitrofuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142611743 |
| Molecular Formula | C16H12N2O6S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (5Z)-3-(3-hydroxy-4,5-dimethylphenyl)-5-[(5-nitrofuran-2-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(N2C(=O)S/C(=C\c3ccc([N+](=O)[O-])o3)C2=O)cc(O)c1C |
| InChI | InChI=1S/C16H12N2O6S/c1-8-5-10(6-12(19)9(8)2)17-15(20)13(25-16(17)21)7-11-3-4-14(24-11)18(22)23/h3-7,19H,1-2H3/b13-7- |
| InChIKey | FLHULBLYEFFWKG-QPEQYQDCSA-N |
| XLogP | 3.75 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|