C21H32O2 — CID 142612869
(8R,10S,13S)-10-ethyl-13-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-one (PubChem CID 142612869) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (8R,10S,13S)-10-ethyl-13-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-one.
| Compound Name | (8R,10S,13S)-10-ethyl-13-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-one |
|---|---|
| PubChem CID | 142612869 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (8R,10S,13S)-10-ethyl-13-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,2'-oxirane]-17-one |
| SMILES | CC[C@]12CCC3(CO3)CC1CC[C@@H]1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C21H32O2/c1-3-21-11-10-20(13-23-20)12-14(21)4-5-15-16-6-7-18(22)19(16,2)9-8-17(15)21/h14-17H,3-13H2,1-2H3/t14?,15-,16?,17?,19-,20?,21-/m0/s1 |
| InChIKey | KIFCWPNQVRLUPI-LKUTWLRVSA-N |
| XLogP | 4.76 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|