C27H44O2 — CID 157161493
(5'R,8'R,9'S,10'S,13'S,14'S)-10'-ethyl-17'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 157161493) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (5'R,8'R,9'S,10'S,13'S,14'S)-10'-ethyl-17'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | (5'R,8'R,9'S,10'S,13'S,14'S)-10'-ethyl-17'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 157161493 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (5'R,8'R,9'S,10'S,13'S,14'S)-10'-ethyl-17'-ethylidene-5,5,13'-trimethylspiro[1,3-dioxane-2,3'-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | CC=C1CC[C@H]2[C@@H]3CC[C@@H]4CC5(CC[C@]4(CC)[C@H]3CC[C@]12C)OCC(C)(C)CO5 |
| InChI | InChI=1S/C27H44O2/c1-6-19-9-11-22-21-10-8-20-16-27(28-17-24(3,4)18-29-27)15-14-26(20,7-2)23(21)12-13-25(19,22)5/h6,20-23H,7-18H2,1-5H3/t20-,21+,22+,23+,25-,26+/m1/s1 |
| InChIKey | ZJUOGJYBJQTKER-SVCGTXNNSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|