C23H35N3O2 — CID 142613053
1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)-4-(4-pentoxycyclohexyl)butan-1-one (PubChem CID 142613053) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)-4-(4-pentoxycyclohexyl)butan-1-one.
| Compound Name | 1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)-4-(4-pentoxycyclohexyl)butan-1-one |
|---|---|
| PubChem CID | 142613053 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)-4-(4-pentoxycyclohexyl)butan-1-one |
| SMILES | CCCCCOC1CCC(CCCC(=O)c2cnn3c(C)cc(C)nc23)CC1 |
| InChI | InChI=1S/C23H35N3O2/c1-4-5-6-14-28-20-12-10-19(11-13-20)8-7-9-22(27)21-16-24-26-18(3)15-17(2)25-23(21)26/h15-16,19-20H,4-14H2,1-3H3 |
| InChIKey | XTNIFROQRFXXPO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|