About 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide
2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 142615466) has the molecular formula C23H18F3N3O2
and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 142615466 |
| Molecular Formula | C23H18F3N3O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(-c3cnc4ccccn34)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H18F3N3O2/c1-15-5-8-17(12-19(15)23(24,25)26)28-22(30)14-31-18-9-6-16(7-10-18)20-13-27-21-4-2-3-11-29(20)21/h2-13H,14H2,1H3,(H,28,30) |
| InChIKey | PCQLCHOOMYDVJN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (CID 142615466) is 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide is Cc1ccc(NC(=O)COc2ccc(-c3cnc4ccccn34)cc2)cc1C(F)(F)F.
What is the InChIKey of 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide?
The InChIKey is PCQLCHOOMYDVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3N3O2/c1-15-5-8-17(12-19(15)23(24,25)26)28-22(30)14-31-18-9-6-16(7-10-18)20-13-27-21-4-2-3-11-29(20)21/h2-13H,14H2,1H3,(H,28,30).
What are the key properties of 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide?
2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide has a molecular weight of 425.41 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-imidazo[1,2-a]pyridin-3-ylphenoxy)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 142615466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).