About N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane
N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane (PubChem CID 142616069) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane.
Molecular Properties
| Compound Name | N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane |
| PubChem CID | 142616069 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane |
| SMILES | CC.CC#CCOCCCN(C)CC(C)C |
| InChI | InChI=1S/C12H23NO.C2H6/c1-5-6-9-14-10-7-8-13(4)11-12(2)3;1-2/h12H,7-11H2,1-4H3;1-2H3 |
| InChIKey | OGMMMQXDUJGPAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane?
The IUPAC name of N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane (CID 142616069) is N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane.
What is the SMILES notation for N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane?
The canonical SMILES for N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane is CC.CC#CCOCCCN(C)CC(C)C.
What is the InChIKey of N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane?
The InChIKey is OGMMMQXDUJGPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO.C2H6/c1-5-6-9-14-10-7-8-13(4)11-12(2)3;1-2/h12H,7-11H2,1-4H3;1-2H3.
What are the key properties of N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane?
N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane has a molecular weight of 227.39 g/mol, XLogP of 3.03, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-but-2-ynoxypropyl)-N,2-dimethylpropan-1-amine;ethane is sourced from PubChem (CID 142616069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).