About N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine
N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine (PubChem CID 135254240) has the molecular formula C8H18INO
and a molecular weight of 271.14 g/mol. Its IUPAC name is N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine |
| PubChem CID | 135254240 |
| Molecular Formula | C8H18INO |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine |
| SMILES | CC(C)CN(C)CCOCI |
| InChI | InChI=1S/C8H18INO/c1-8(2)6-10(3)4-5-11-7-9/h8H,4-7H2,1-3H3 |
| InChIKey | ULUIELPGGQTXSN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine?
The IUPAC name of N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine (CID 135254240) is N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine.
What is the SMILES notation for N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine?
The canonical SMILES for N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine is CC(C)CN(C)CCOCI.
What is the InChIKey of N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine?
The InChIKey is ULUIELPGGQTXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18INO/c1-8(2)6-10(3)4-5-11-7-9/h8H,4-7H2,1-3H3.
What are the key properties of N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine?
N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine has a molecular weight of 271.14 g/mol, XLogP of 1.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(iodomethoxy)ethyl]-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 135254240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).