C15H36N2O2 — CID 167553463
N,2-dimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]propan-1-amine;methane (PubChem CID 167553463) has the molecular formula C15H36N2O2 and a molecular weight of 276.46 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]propan-1-amine;methane.
| Compound Name | N,2-dimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]propan-1-amine;methane |
|---|---|
| PubChem CID | 167553463 |
| Molecular Formula | C15H36N2O2 |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | N,2-dimethyl-N-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethyl]propan-1-amine;methane |
| SMILES | C.CC(C)CN(C)CCOCCOCCNC(C)C |
| InChI | InChI=1S/C14H32N2O2.CH4/c1-13(2)12-16(5)7-9-18-11-10-17-8-6-15-14(3)4;/h13-15H,6-12H2,1-5H3;1H4 |
| InChIKey | CSAAWMCMZXZWHO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|