C11H12N2 — CID 142616291
(3aE,5Z,7Z,9E)-2,3-dimethylcycloocta[d]imidazole (PubChem CID 142616291) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is (3aE,5Z,7Z,9E)-2,3-dimethylcycloocta[d]imidazole.
| Compound Name | (3aE,5Z,7Z,9E)-2,3-dimethylcycloocta[d]imidazole |
|---|---|
| PubChem CID | 142616291 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (3aE,5Z,7Z,9E)-2,3-dimethylcycloocta[d]imidazole |
| SMILES | Cc1nc2/c(n1C)=C\C=C/C=C\C=2 |
| InChI | InChI=1S/C11H12N2/c1-9-12-10-7-5-3-4-6-8-11(10)13(9)2/h3-8H,1-2H3/b4-3-,5-3-,6-4-,7-5-,8-6-,10-7+,11-8+ |
| InChIKey | MWQMWSZRAAXEBT-QAOJABQXSA-N |
| XLogP | 0.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |