C22H22N2O5 — CID 142617347
4-[[(6aS)-2-methoxy-14-oxo-7,12-dihydro-6aH-isoquinolino[3,2-c][1,4]benzodiazepin-3-yl]oxy]butanoic acid (PubChem CID 142617347) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[[(6aS)-2-methoxy-14-oxo-7,12-dihydro-6aH-isoquinolino[3,2-c][1,4]benzodiazepin-3-yl]oxy]butanoic acid.
| Compound Name | 4-[[(6aS)-2-methoxy-14-oxo-7,12-dihydro-6aH-isoquinolino[3,2-c][1,4]benzodiazepin-3-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 142617347 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4-[[(6aS)-2-methoxy-14-oxo-7,12-dihydro-6aH-isoquinolino[3,2-c][1,4]benzodiazepin-3-yl]oxy]butanoic acid |
| SMILES | COc1cc2c(cc1OCCCC(=O)O)N=C[C@@H]1Cc3ccccc3CN1C2=O |
| InChI | InChI=1S/C22H22N2O5/c1-28-19-10-17-18(11-20(19)29-8-4-7-21(25)26)23-12-16-9-14-5-2-3-6-15(14)13-24(16)22(17)27/h2-3,5-6,10-12,16H,4,7-9,13H2,1H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | YOWHRVCHOCVRCA-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|