C41H43N5O9 — CID 163625199
4-[[2,6-bis[[(8E)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]-4-pyridinyl]oxy]butanoic acid (PubChem CID 163625199) has the molecular formula C41H43N5O9 and a molecular weight of 749.82 g/mol. Its IUPAC name is 4-[[2,6-bis[[(8E)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]-4-pyridinyl]oxy]butanoic acid.
| Compound Name | 4-[[2,6-bis[[(8E)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]-4-pyridinyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 163625199 |
| Molecular Formula | C41H43N5O9 |
| Molecular Weight | 749.82 g/mol |
| Exact Mass | 749.31 |
| IUPAC Name | 4-[[2,6-bis[[(8E)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]-4-pyridinyl]oxy]butanoic acid |
| SMILES | C/C=C1\CC2C=Nc3cc(OCc4cc(OCCCC(=O)O)cc(COc5cc6c(cc5OC)C(=O)N5C/C(=C/C)CC5C=N6)n4)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C41H43N5O9/c1-5-24-10-28-18-42-33-16-37(35(51-3)14-31(33)40(49)45(28)20-24)54-22-26-12-30(53-9-7-8-39(47)48)13-27(44-26)23-55-38-17-34-32(15-36(38)52-4)41(50)46-21-25(6-2)11-29(46)19-43-34/h5-6,12-19,28-29H,7-11,20-23H2,1-4H3,(H,47,48)/b24-5+,25-6+ |
| InChIKey | HRKSIGMXKUQLAG-DRHOZWAUSA-N |
| XLogP | 6.25 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.82 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|