C44H44N4O8 — CID 91545609
6-[3,5-bis[[(6aS)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]phenyl]hex-5-ynoic acid (PubChem CID 91545609) has the molecular formula C44H44N4O8 and a molecular weight of 756.86 g/mol. Its IUPAC name is 6-[3,5-bis[[(6aS)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]phenyl]hex-5-ynoic acid.
| Compound Name | 6-[3,5-bis[[(6aS)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]phenyl]hex-5-ynoic acid |
|---|---|
| PubChem CID | 91545609 |
| Molecular Formula | C44H44N4O8 |
| Molecular Weight | 756.86 g/mol |
| Exact Mass | 756.32 |
| IUPAC Name | 6-[3,5-bis[[(6aS)-8-ethylidene-2-methoxy-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl]oxymethyl]phenyl]hex-5-ynoic acid |
| SMILES | CC=C1C[C@H]2C=Nc3cc(OCc4cc(C#CCCCC(=O)O)cc(COc5cc6c(cc5OC)C(=O)N5CC(=CC)C[C@H]5C=N6)c4)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C44H44N4O8/c1-5-27-15-32-21-45-36-19-40(38(53-3)17-34(36)43(51)47(32)23-27)55-25-30-12-29(10-8-7-9-11-42(49)50)13-31(14-30)26-56-41-20-37-35(18-39(41)54-4)44(52)48-24-28(6-2)16-33(48)22-46-37/h5-6,12-14,17-22,32-33H,7,9,11,15-16,23-26H2,1-4H3,(H,49,50)/t32-,33-/m0/s1 |
| InChIKey | RMSWCMKFHYARCO-LQJZCPKCSA-N |
| XLogP | 7.22 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|