C42H26N2OV — CID 142619055
2-naphtho[1,2-b][1]benzofuran-9-yl-4-[3-(4-phenylphenyl)phenyl]quinazoline;vanadium (PubChem CID 142619055) has the molecular formula C42H26N2OV and a molecular weight of 625.63 g/mol. Its IUPAC name is 2-naphtho[1,2-b][1]benzofuran-9-yl-4-[3-(4-phenylphenyl)phenyl]quinazoline;vanadium.
| Compound Name | 2-naphtho[1,2-b][1]benzofuran-9-yl-4-[3-(4-phenylphenyl)phenyl]quinazoline;vanadium |
|---|---|
| PubChem CID | 142619055 |
| Molecular Formula | C42H26N2OV |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | 2-naphtho[1,2-b][1]benzofuran-9-yl-4-[3-(4-phenylphenyl)phenyl]quinazoline;vanadium |
| SMILES | [V].c1ccc(-c2ccc(-c3cccc(-c4nc(-c5ccc6c(c5)oc5c7ccccc7ccc65)nc5ccccc45)c3)cc2)cc1 |
| InChI | InChI=1S/C42H26N2O.V/c1-2-9-27(10-3-1)28-17-19-29(20-18-28)31-12-8-13-32(25-31)40-37-15-6-7-16-38(37)43-42(44-40)33-22-23-35-36-24-21-30-11-4-5-14-34(30)41(36)45-39(35)26-33;/h1-26H; |
| InChIKey | AHAJLJZNAIBOEK-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |