C21H32O7 — CID 142619440
methyl 2-[(6aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]acetate (PubChem CID 142619440) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is methyl 2-[(6aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]acetate.
| Compound Name | methyl 2-[(6aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]acetate |
|---|---|
| PubChem CID | 142619440 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | methyl 2-[(6aS)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]acetate |
| SMILES | COC(=O)CC1OC([C@H]2COC3(CCCCC3)O2)C2OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C21H32O7/c1-23-16(22)12-14-18-19(28-21(27-18)10-6-3-7-11-21)17(25-14)15-13-24-20(26-15)8-4-2-5-9-20/h14-15,17-19H,2-13H2,1H3/t14?,15-,17?,18+,19?/m1/s1 |
| InChIKey | YYGRJLRCAVDDOA-BBMWLUAISA-N |
| XLogP | 2.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |