C32H44O20 — CID 139056507
[(2R)-2-[(2S,3S,3aR,6aR)-3-acetyloxy-6a-ethoxy-5-oxo-2,3,3a,6-tetrahydrofuro[3,2-b]furan-2-yl]-2-acetyloxyethyl] acetate (PubChem CID 139056507) has the molecular formula C32H44O20 and a molecular weight of 748.68 g/mol. Its IUPAC name is [(2R)-2-[(2S,3S,3aR,6aR)-3-acetyloxy-6a-ethoxy-5-oxo-2,3,3a,6-tetrahydrofuro[3,2-b]furan-2-yl]-2-acetyloxyethyl] acetate.
| Compound Name | [(2R)-2-[(2S,3S,3aR,6aR)-3-acetyloxy-6a-ethoxy-5-oxo-2,3,3a,6-tetrahydrofuro[3,2-b]furan-2-yl]-2-acetyloxyethyl] acetate |
|---|---|
| PubChem CID | 139056507 |
| Molecular Formula | C32H44O20 |
| Molecular Weight | 748.68 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | [(2R)-2-[(2S,3S,3aR,6aR)-3-acetyloxy-6a-ethoxy-5-oxo-2,3,3a,6-tetrahydrofuro[3,2-b]furan-2-yl]-2-acetyloxyethyl] acetate |
| SMILES | CCO[C@@]12CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H]([C@@H](COC(C)=O)OC(C)=O)O2.CCO[C@@]12CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H]([C@@H](COC(C)=O)OC(C)=O)O2 |
| InChI | InChI=1S/2C16H22O10/c2*1-5-22-16-6-12(20)25-15(16)14(24-10(4)19)13(26-16)11(23-9(3)18)7-21-8(2)17/h2*11,13-15H,5-7H2,1-4H3/t2*11-,13+,14+,15-,16-/m11/s1 |
| InChIKey | HYCZDNHYQXAMRU-SYKVKNSTSA-N |
| XLogP | -0.28 |
| TPSA | 247.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.68 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|