C20H28O8 — CID 139091092
(3aR,5S,5'S,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one (PubChem CID 139091092) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is (3aR,5S,5'S,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one.
| Compound Name | (3aR,5S,5'S,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 139091092 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (3aR,5S,5'S,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
| SMILES | C[C@H]1CC[C@]2(C[C@H]3OC(=O)C[C@H]3O2)O1.C[C@H]1CC[C@]2(C[C@H]3OC(=O)C[C@H]3O2)O1 |
| InChI | InChI=1S/2C10H14O4/c2*1-6-2-3-10(13-6)5-8-7(14-10)4-9(11)12-8/h2*6-8H,2-5H2,1H3/t2*6-,7+,8+,10-/m00/s1 |
| InChIKey | RDZQWOCZXGXTBA-GZTGIGAASA-N |
| XLogP | 1.97 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |