C10H14O4 — CID 162883579
(3aR,5S,5'R,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one (PubChem CID 162883579) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (3aR,5S,5'R,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one.
| Compound Name | (3aR,5S,5'R,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 162883579 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (3aR,5S,5'R,6aR)-5'-methylspiro[3,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-2-one |
| SMILES | C[C@@H]1CC[C@]2(C[C@H]3OC(=O)C[C@H]3O2)O1 |
| InChI | InChI=1S/C10H14O4/c1-6-2-3-10(13-6)5-8-7(14-10)4-9(11)12-8/h6-8H,2-5H2,1H3/t6-,7-,8-,10+/m1/s1 |
| InChIKey | XNJDUGALSDZUTA-DQUBFYRCSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |