C10H16O3 — CID 10932103
(2R,3aR,6aR)-2-butyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 10932103) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (2R,3aR,6aR)-2-butyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2R,3aR,6aR)-2-butyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 10932103 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R,3aR,6aR)-2-butyl-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CCCC[C@@H]1C[C@H]2OC(=O)C[C@H]2O1 |
| InChI | InChI=1S/C10H16O3/c1-2-3-4-7-5-8-9(12-7)6-10(11)13-8/h7-9H,2-6H2,1H3/t7-,8-,9-/m1/s1 |
| InChIKey | JGFVINCBIYOEIW-IWSPIJDZSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |