C26H29NO2 — CID 142619516
3-benzyl-3-methyl-N-(2-methylphenyl)-2H-1-benzofuran-5-carboxamide;ethane (PubChem CID 142619516) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-benzyl-3-methyl-N-(2-methylphenyl)-2H-1-benzofuran-5-carboxamide;ethane.
| Compound Name | 3-benzyl-3-methyl-N-(2-methylphenyl)-2H-1-benzofuran-5-carboxamide;ethane |
|---|---|
| PubChem CID | 142619516 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-benzyl-3-methyl-N-(2-methylphenyl)-2H-1-benzofuran-5-carboxamide;ethane |
| SMILES | CC.Cc1ccccc1NC(=O)c1ccc2c(c1)C(C)(Cc1ccccc1)CO2 |
| InChI | InChI=1S/C24H23NO2.C2H6/c1-17-8-6-7-11-21(17)25-23(26)19-12-13-22-20(14-19)24(2,16-27-22)15-18-9-4-3-5-10-18;1-2/h3-14H,15-16H2,1-2H3,(H,25,26);1-2H3 |
| InChIKey | LLKHHBUCOGMJER-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |