C17H15F3N2O2 — CID 142619963
ethyl 7-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylate (PubChem CID 142619963) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is ethyl 7-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 142619963 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | ethyl 7-(3,4,5-trifluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)CN(c1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C17H15F3N2O2/c1-2-24-17(23)15-5-10-3-4-22(9-11(10)8-21-15)12-6-13(18)16(20)14(19)7-12/h5-8H,2-4,9H2,1H3 |
| InChIKey | PFUWAVCHFCCOTJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|