About 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid
7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid (PubChem CID 139320916) has the molecular formula C15H12BrFN2O2
and a molecular weight of 351.18 g/mol. Its IUPAC name is 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid |
| PubChem CID | 139320916 |
| Molecular Formula | C15H12BrFN2O2 |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc2c(cn1)CN(c1cc(F)cc(Br)c1)CC2 |
| InChI | InChI=1S/C15H12BrFN2O2/c16-11-4-12(17)6-13(5-11)19-2-1-9-3-14(15(20)21)18-7-10(9)8-19/h3-7H,1-2,8H2,(H,20,21) |
| InChIKey | OCAUPZPURCCHEA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid?
The IUPAC name of 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid (CID 139320916) is 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid?
The canonical SMILES for 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid is O=C(O)c1cc2c(cn1)CN(c1cc(F)cc(Br)c1)CC2.
What is the InChIKey of 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid?
The InChIKey is OCAUPZPURCCHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrFN2O2/c16-11-4-12(17)6-13(5-11)19-2-1-9-3-14(15(20)21)18-7-10(9)8-19/h3-7H,1-2,8H2,(H,20,21).
What are the key properties of 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid?
7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid has a molecular weight of 351.18 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-bromo-5-fluorophenyl)-6,8-dihydro-5H-2,7-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 139320916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).