C21H27FN4O3 — CID 142620895
N-[2-(2-amino-3-fluoroanilino)-1-cyclooctyl-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 142620895) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[2-(2-amino-3-fluoroanilino)-1-cyclooctyl-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[2-(2-amino-3-fluoroanilino)-1-cyclooctyl-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 142620895 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[2-(2-amino-3-fluoroanilino)-1-cyclooctyl-2-oxoethyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1nocc1C(=O)NC(C(=O)Nc1cccc(F)c1N)C1CCCCCCC1 |
| InChI | InChI=1S/C21H27FN4O3/c1-13-15(12-29-26-13)20(27)25-19(14-8-5-3-2-4-6-9-14)21(28)24-17-11-7-10-16(22)18(17)23/h7,10-12,14,19H,2-6,8-9,23H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | MAKKGXGHVFSSIE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|