C48H43N5 — CID 142622060
benzenecarboximidamide;[3-[5-[3-(1,2-dihydrocarbazol-9-yl)phenyl]quinolin-4-yl]phenyl]methanamine;toluene (PubChem CID 142622060) has the molecular formula C48H43N5 and a molecular weight of 689.91 g/mol. Its IUPAC name is benzenecarboximidamide;[3-[5-[3-(1,2-dihydrocarbazol-9-yl)phenyl]quinolin-4-yl]phenyl]methanamine;toluene.
| Compound Name | benzenecarboximidamide;[3-[5-[3-(1,2-dihydrocarbazol-9-yl)phenyl]quinolin-4-yl]phenyl]methanamine;toluene |
|---|---|
| PubChem CID | 142622060 |
| Molecular Formula | C48H43N5 |
| Molecular Weight | 689.91 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | benzenecarboximidamide;[3-[5-[3-(1,2-dihydrocarbazol-9-yl)phenyl]quinolin-4-yl]phenyl]methanamine;toluene |
| SMILES | Cc1ccccc1.NCc1cccc(-c2ccnc3cccc(-c4cccc(-n5c6c(c7ccccc75)C=CCC6)c4)c23)c1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C34H27N3.C7H8N2.C7H8/c35-22-23-8-5-9-24(20-23)28-18-19-36-31-15-7-14-27(34(28)31)25-10-6-11-26(21-25)37-32-16-3-1-12-29(32)30-13-2-4-17-33(30)37;8-7(9)6-4-2-1-3-5-6;1-7-5-3-2-4-6-7/h1-3,5-16,18-21H,4,17,22,35H2;1-5H,(H3,8,9);2-6H,1H3 |
| InChIKey | SATMGPHXNDZYHY-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.91 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|