C13H15N3OS — CID 142622996
(E)-N-(2-aminocyclohexa-1,5-dien-1-yl)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 142622996) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is (E)-N-(2-aminocyclohexa-1,5-dien-1-yl)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-aminocyclohexa-1,5-dien-1-yl)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 142622996 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E)-N-(2-aminocyclohexa-1,5-dien-1-yl)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1ncc(/C=C/C(=O)NC2=C(N)CCC=C2)s1 |
| InChI | InChI=1S/C13H15N3OS/c1-9-15-8-10(18-9)6-7-13(17)16-12-5-3-2-4-11(12)14/h3,5-8H,2,4,14H2,1H3,(H,16,17)/b7-6+ |
| InChIKey | XUVJHXDAMRXBON-VOTSOKGWSA-N |
| XLogP | 2.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|