C10H26N2O — CID 142624201
N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen (PubChem CID 142624201) has the molecular formula C10H26N2O and a molecular weight of 190.33 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen.
| Compound Name | N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen |
|---|---|
| PubChem CID | 142624201 |
| Molecular Formula | C10H26N2O |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.20 |
| IUPAC Name | N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen |
| SMILES | CC[C@@H]1CNC[C@H](C)C1.CN(C)O.[H][H] |
| InChI | InChI=1S/C8H17N.C2H7NO.H2/c1-3-8-4-7(2)5-9-6-8;1-3(2)4;/h7-9H,3-6H2,1-2H3;4H,1-2H3;1H/t7-,8+;;/m1../s1 |
| InChIKey | SUUXFSDUDRAIOL-YUZCMTBUSA-N |
| XLogP | 1.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|