About N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen
N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen (PubChem CID 142624201) has the molecular formula C10H26N2O
and a molecular weight of 190.33 g/mol. Its IUPAC name is N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen.
Molecular Properties
| Compound Name | N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen |
| PubChem CID | 142624201 |
| Molecular Formula | C10H26N2O |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.20 |
| IUPAC Name | N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen |
| SMILES | CC[C@@H]1CNC[C@H](C)C1.CN(C)O.[H][H] |
| InChI | InChI=1S/C8H17N.C2H7NO.H2/c1-3-8-4-7(2)5-9-6-8;1-3(2)4;/h7-9H,3-6H2,1-2H3;4H,1-2H3;1H/t7-,8+;;/m1../s1 |
| InChIKey | SUUXFSDUDRAIOL-YUZCMTBUSA-N |
| XLogP | 1.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen?
The IUPAC name of N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen (CID 142624201) is N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen.
What is the SMILES notation for N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen?
The canonical SMILES for N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen is CC[C@@H]1CNC[C@H](C)C1.CN(C)O.[H][H].
What is the InChIKey of N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen?
The InChIKey is SUUXFSDUDRAIOL-YUZCMTBUSA-N. The full InChI is InChI=1S/C8H17N.C2H7NO.H2/c1-3-8-4-7(2)5-9-6-8;1-3(2)4;/h7-9H,3-6H2,1-2H3;4H,1-2H3;1H/t7-,8+;;/m1../s1.
What are the key properties of N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen?
N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen has a molecular weight of 190.33 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylhydroxylamine;(3S,5R)-3-ethyl-5-methylpiperidine;molecular hydrogen is sourced from PubChem (CID 142624201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).