About azane;3,5-dimethylpiperidine
azane;3,5-dimethylpiperidine (PubChem CID 23174858) has the molecular formula C7H18N2
and a molecular weight of 130.24 g/mol. Its IUPAC name is azane;3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | azane;3,5-dimethylpiperidine |
| PubChem CID | 23174858 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | azane;3,5-dimethylpiperidine |
| SMILES | CC1CNCC(C)C1.N |
| InChI | InChI=1S/C7H15N.H3N/c1-6-3-7(2)5-8-4-6;/h6-8H,3-5H2,1-2H3;1H3 |
| InChIKey | VOEWHIWWERBHOS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,5-dimethylpiperidine?
The IUPAC name of azane;3,5-dimethylpiperidine (CID 23174858) is azane;3,5-dimethylpiperidine.
What is the SMILES notation for azane;3,5-dimethylpiperidine?
The canonical SMILES for azane;3,5-dimethylpiperidine is CC1CNCC(C)C1.N.
What is the InChIKey of azane;3,5-dimethylpiperidine?
The InChIKey is VOEWHIWWERBHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.H3N/c1-6-3-7(2)5-8-4-6;/h6-8H,3-5H2,1-2H3;1H3.
What are the key properties of azane;3,5-dimethylpiperidine?
azane;3,5-dimethylpiperidine has a molecular weight of 130.24 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,5-dimethylpiperidine is sourced from PubChem (CID 23174858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).