C7H18N2 — CID 23174858
azane;3,5-dimethylpiperidine (PubChem CID 23174858) has the molecular formula C7H18N2 and a molecular weight of 130.24 g/mol. Its IUPAC name is azane;3,5-dimethylpiperidine.
| Compound Name | azane;3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 23174858 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | azane;3,5-dimethylpiperidine |
| SMILES | CC1CNCC(C)C1.N |
| InChI | InChI=1S/C7H15N.H3N/c1-6-3-7(2)5-8-4-6;/h6-8H,3-5H2,1-2H3;1H3 |
| InChIKey | VOEWHIWWERBHOS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |