C21H41N — CID 155407572
3,7-dimethyl-5-(1-methylcycloundecyl)azocane (PubChem CID 155407572) has the molecular formula C21H41N and a molecular weight of 307.57 g/mol. Its IUPAC name is 3,7-dimethyl-5-(1-methylcycloundecyl)azocane.
| Compound Name | 3,7-dimethyl-5-(1-methylcycloundecyl)azocane |
|---|---|
| PubChem CID | 155407572 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | 3,7-dimethyl-5-(1-methylcycloundecyl)azocane |
| SMILES | CC1CNCC(C)CC(C2(C)CCCCCCCCCC2)C1 |
| InChI | InChI=1S/C21H41N/c1-18-14-20(15-19(2)17-22-16-18)21(3)12-10-8-6-4-5-7-9-11-13-21/h18-20,22H,4-17H2,1-3H3 |
| InChIKey | SKXZQJARHTUFTE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |