C6H11NO2S — CID 142625321
2-(2-methoxyethyl)-1,3-thiazolidin-4-one (PubChem CID 142625321) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-methoxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142625321 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2-(2-methoxyethyl)-1,3-thiazolidin-4-one |
| SMILES | COCCC1NC(=O)CS1 |
| InChI | InChI=1S/C6H11NO2S/c1-9-3-2-6-7-5(8)4-10-6/h6H,2-4H2,1H3,(H,7,8) |
| InChIKey | ARBVGYUYFBFNDS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |