C7H11N3O5S — CID 142625680
3-(4-carbamoyl-2-oxo-1,3-thiazolidin-3-yl)propyl nitrate (PubChem CID 142625680) has the molecular formula C7H11N3O5S and a molecular weight of 249.25 g/mol. Its IUPAC name is 3-(4-carbamoyl-2-oxo-1,3-thiazolidin-3-yl)propyl nitrate.
| Compound Name | 3-(4-carbamoyl-2-oxo-1,3-thiazolidin-3-yl)propyl nitrate |
|---|---|
| PubChem CID | 142625680 |
| Molecular Formula | C7H11N3O5S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 3-(4-carbamoyl-2-oxo-1,3-thiazolidin-3-yl)propyl nitrate |
| SMILES | NC(=O)C1CSC(=O)N1CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C7H11N3O5S/c8-6(11)5-4-16-7(12)9(5)2-1-3-15-10(13)14/h5H,1-4H2,(H2,8,11) |
| InChIKey | BPHOOLDUPINBBQ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|