C9H15N3 — CID 142625788
1-methyl-5,6,7,8-tetrahydro-2H-quinazolin-4-amine (PubChem CID 142625788) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-methyl-5,6,7,8-tetrahydro-2H-quinazolin-4-amine.
| Compound Name | 1-methyl-5,6,7,8-tetrahydro-2H-quinazolin-4-amine |
|---|---|
| PubChem CID | 142625788 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-methyl-5,6,7,8-tetrahydro-2H-quinazolin-4-amine |
| SMILES | CN1CN=C(N)C2=C1CCCC2 |
| InChI | InChI=1S/C9H15N3/c1-12-6-11-9(10)7-4-2-3-5-8(7)12/h2-6H2,1H3,(H2,10,11) |
| InChIKey | RTJLGAZHIYRRDX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |