C10H15N3 — CID 54589513
N,3-dimethyl-5,6,7,8-tetrahydroquinazolin-4-imine (PubChem CID 54589513) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N,3-dimethyl-5,6,7,8-tetrahydroquinazolin-4-imine.
| Compound Name | N,3-dimethyl-5,6,7,8-tetrahydroquinazolin-4-imine |
|---|---|
| PubChem CID | 54589513 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N,3-dimethyl-5,6,7,8-tetrahydroquinazolin-4-imine |
| SMILES | C/N=c1/c2c(ncn1C)CCCC2 |
| InChI | InChI=1S/C10H15N3/c1-11-10-8-5-3-4-6-9(8)12-7-13(10)2/h7H,3-6H2,1-2H3/b11-10- |
| InChIKey | UVGMJJAIQDKXPX-KHPPLWFESA-N |
| XLogP | 0.83 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |