C14H23N3 — CID 54589594
N,3-dipropyl-5,6,7,8-tetrahydroquinazolin-4-imine (PubChem CID 54589594) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N,3-dipropyl-5,6,7,8-tetrahydroquinazolin-4-imine.
| Compound Name | N,3-dipropyl-5,6,7,8-tetrahydroquinazolin-4-imine |
|---|---|
| PubChem CID | 54589594 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N,3-dipropyl-5,6,7,8-tetrahydroquinazolin-4-imine |
| SMILES | CCC/N=c1/c2c(ncn1CCC)CCCC2 |
| InChI | InChI=1S/C14H23N3/c1-3-9-15-14-12-7-5-6-8-13(12)16-11-17(14)10-4-2/h11H,3-10H2,1-2H3/b15-14- |
| InChIKey | ARJPEKGARYCNDD-PFONDFGASA-N |
| XLogP | 2.48 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |