C13H21N2+ — CID 23344254
8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene (PubChem CID 23344254) has the molecular formula C13H21N2+ and a molecular weight of 205.32 g/mol. Its IUPAC name is 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene.
| Compound Name | 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene |
|---|---|
| PubChem CID | 23344254 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 8,13-dimethyl-8-aza-1-azoniatricyclo[7.4.0.03,7]trideca-1(9),3(7)-diene |
| SMILES | CC1CCCC2=[N+]1CC1=C(CCC1)N2C |
| InChI | InChI=1S/C13H21N2/c1-10-5-3-8-13-14(2)12-7-4-6-11(12)9-15(10)13/h10H,3-9H2,1-2H3/q+1 |
| InChIKey | QOAVIEFKZNTLMO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|