C11H16N2 — CID 150872813
2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]indole (PubChem CID 150872813) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]indole.
| Compound Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]indole |
|---|---|
| PubChem CID | 150872813 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]indole |
| SMILES | C1CCC2=C(C1)CC1=NCCCN12 |
| InChI | InChI=1S/C11H16N2/c1-2-5-10-9(4-1)8-11-12-6-3-7-13(10)11/h1-8H2 |
| InChIKey | KUJWWXNNAPXEIB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |