C12H19N3 — CID 54589514
N,3-diethyl-5,6,7,8-tetrahydroquinazolin-4-imine (PubChem CID 54589514) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N,3-diethyl-5,6,7,8-tetrahydroquinazolin-4-imine.
| Compound Name | N,3-diethyl-5,6,7,8-tetrahydroquinazolin-4-imine |
|---|---|
| PubChem CID | 54589514 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N,3-diethyl-5,6,7,8-tetrahydroquinazolin-4-imine |
| SMILES | CC/N=c1/c2c(ncn1CC)CCCC2 |
| InChI | InChI=1S/C12H19N3/c1-3-13-12-10-7-5-6-8-11(10)14-9-15(12)4-2/h9H,3-8H2,1-2H3/b13-12- |
| InChIKey | XWLVBHHNFHQVBH-SEYXRHQNSA-N |
| XLogP | 1.70 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |