C13H20ClNO2 — CID 142628633
2-amino-1-chloro-2-(3-phenylbutyl)propane-1,3-diol (PubChem CID 142628633) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2-amino-1-chloro-2-(3-phenylbutyl)propane-1,3-diol.
| Compound Name | 2-amino-1-chloro-2-(3-phenylbutyl)propane-1,3-diol |
|---|---|
| PubChem CID | 142628633 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-amino-1-chloro-2-(3-phenylbutyl)propane-1,3-diol |
| SMILES | CC(CCC(N)(CO)C(O)Cl)c1ccccc1 |
| InChI | InChI=1S/C13H20ClNO2/c1-10(11-5-3-2-4-6-11)7-8-13(15,9-16)12(14)17/h2-6,10,12,16-17H,7-9,15H2,1H3 |
| InChIKey | CDKWTLHLBOLJSV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|