About acetyloxymercury;mercury(1+);nitrate
acetyloxymercury;mercury(1+);nitrate (PubChem CID 142629064) has the molecular formula C2H3Hg2NO5
and a molecular weight of 522.23 g/mol. Its IUPAC name is acetyloxymercury;mercury(1+);nitrate.
Molecular Properties
| Compound Name | acetyloxymercury;mercury(1+);nitrate |
| PubChem CID | 142629064 |
| Molecular Formula | C2H3Hg2NO5 |
| Molecular Weight | 522.23 g/mol |
| Exact Mass | 524.94 |
| IUPAC Name | acetyloxymercury;mercury(1+);nitrate |
| SMILES | CC(=O)O[Hg].O=[N+]([O-])[O-].[Hg+] |
| InChI | InChI=1S/C2H4O2.2Hg.NO3/c1-2(3)4;;;2-1(3)4/h1H3,(H,3,4);;;/q;2*+1;-1/p-1 |
| InChIKey | CQODRSCLWYZORN-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyloxymercury;mercury(1+);nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxymercury;mercury(1+);nitrate?
The IUPAC name of acetyloxymercury;mercury(1+);nitrate (CID 142629064) is acetyloxymercury;mercury(1+);nitrate.
What is the SMILES notation for acetyloxymercury;mercury(1+);nitrate?
The canonical SMILES for acetyloxymercury;mercury(1+);nitrate is CC(=O)O[Hg].O=[N+]([O-])[O-].[Hg+].
What is the InChIKey of acetyloxymercury;mercury(1+);nitrate?
The InChIKey is CQODRSCLWYZORN-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.2Hg.NO3/c1-2(3)4;;;2-1(3)4/h1H3,(H,3,4);;;/q;2*+1;-1/p-1.
What are the key properties of acetyloxymercury;mercury(1+);nitrate?
acetyloxymercury;mercury(1+);nitrate has a molecular weight of 522.23 g/mol, XLogP of -0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxymercury;mercury(1+);nitrate is sourced from PubChem (CID 142629064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).