C17H15N5O2 — CID 142632899
2-amino-N-(7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-ylmethyl)-5-(1,2,4-triazol-1-yl)benzamide (PubChem CID 142632899) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-amino-N-(7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-ylmethyl)-5-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2-amino-N-(7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-ylmethyl)-5-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 142632899 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-amino-N-(7-oxabicyclo[4.2.0]octa-1(6),2,4-trien-3-ylmethyl)-5-(1,2,4-triazol-1-yl)benzamide |
| SMILES | Nc1ccc(-n2cncn2)cc1C(=O)NCc1ccc2c(c1)CO2 |
| InChI | InChI=1S/C17H15N5O2/c18-15-3-2-13(22-10-19-9-21-22)6-14(15)17(23)20-7-11-1-4-16-12(5-11)8-24-16/h1-6,9-10H,7-8,18H2,(H,20,23) |
| InChIKey | MCDJEELHAVUIBE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|