C22H18N6O5S — CID 55964255
2-[(3-nitrophenyl)sulfonylamino]-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide (PubChem CID 55964255) has the molecular formula C22H18N6O5S and a molecular weight of 478.49 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)sulfonylamino]-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide.
| Compound Name | 2-[(3-nitrophenyl)sulfonylamino]-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55964255 |
| Molecular Formula | C22H18N6O5S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-[(3-nitrophenyl)sulfonylamino]-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(-n2cncn2)cc1)c1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H18N6O5S/c29-22(24-13-16-8-10-17(11-9-16)27-15-23-14-25-27)20-6-1-2-7-21(20)26-34(32,33)19-5-3-4-18(12-19)28(30)31/h1-12,14-15,26H,13H2,(H,24,29) |
| InChIKey | CDFAKEBEGQICQX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 149.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|