2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid

C11H11ClO6 — CID 142633010

IUPAC2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid
SMILESO=C(O)C(O)(Cl)C(O)(Cc1ccccc1)C(=O)O
InChIInChI=1S/C11H11ClO6/c12-11(18,9(15)16)10(17,8(13)14)6-7-4-2-1-3-5-7/h1-5,17-18H,6H2,(H,13,14)(H,15,16)
InChIKeySMHJABQBHYANBJ-UHFFFAOYSA-N
MW274.66 g/mol
LogP0.06
Rot. Bonds5

About 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid

2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid (PubChem CID 142633010) has the molecular formula C11H11ClO6 and a molecular weight of 274.66 g/mol. Its IUPAC name is 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid.

Molecular Properties

Compound Name2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid
PubChem CID142633010
Molecular FormulaC11H11ClO6
Molecular Weight274.66 g/mol
Exact Mass274.02
IUPAC Name2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid
SMILESO=C(O)C(O)(Cl)C(O)(Cc1ccccc1)C(=O)O
InChIInChI=1S/C11H11ClO6/c12-11(18,9(15)16)10(17,8(13)14)6-7-4-2-1-3-5-7/h1-5,17-18H,6H2,(H,13,14)(H,15,16)
InChIKeySMHJABQBHYANBJ-UHFFFAOYSA-N
XLogP0.06
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.66
LogP ≤ 50.06
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid?
The IUPAC name of 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid (CID 142633010) is 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid.
What is the SMILES notation for 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid?
The canonical SMILES for 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid is O=C(O)C(O)(Cl)C(O)(Cc1ccccc1)C(=O)O.
What is the InChIKey of 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid?
The InChIKey is SMHJABQBHYANBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO6/c12-11(18,9(15)16)10(17,8(13)14)6-7-4-2-1-3-5-7/h1-5,17-18H,6H2,(H,13,14)(H,15,16).
What are the key properties of 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid?
2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid has a molecular weight of 274.66 g/mol, XLogP of 0.06, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-chloro-2,3-dihydroxybutanedioic acid is sourced from PubChem (CID 142633010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).