C19H18Cl2F2O — CID 139716581
2,4-dibenzyl-2,4-dichloro-1,5-difluoropentan-3-one (PubChem CID 139716581) has the molecular formula C19H18Cl2F2O and a molecular weight of 371.25 g/mol. Its IUPAC name is 2,4-dibenzyl-2,4-dichloro-1,5-difluoropentan-3-one.
| Compound Name | 2,4-dibenzyl-2,4-dichloro-1,5-difluoropentan-3-one |
|---|---|
| PubChem CID | 139716581 |
| Molecular Formula | C19H18Cl2F2O |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2,4-dibenzyl-2,4-dichloro-1,5-difluoropentan-3-one |
| SMILES | O=C(C(Cl)(CF)Cc1ccccc1)C(Cl)(CF)Cc1ccccc1 |
| InChI | InChI=1S/C19H18Cl2F2O/c20-18(13-22,11-15-7-3-1-4-8-15)17(24)19(21,14-23)12-16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | IRQDQKZVAWDEEB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|