C21H19ClN2O — CID 142633138
6-(4-chlorophenyl)-2-pent-1-ynyl-4-phenyl-4,5-dihydropyridazin-3-one (PubChem CID 142633138) has the molecular formula C21H19ClN2O and a molecular weight of 350.85 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-pent-1-ynyl-4-phenyl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-(4-chlorophenyl)-2-pent-1-ynyl-4-phenyl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 142633138 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 6-(4-chlorophenyl)-2-pent-1-ynyl-4-phenyl-4,5-dihydropyridazin-3-one |
| SMILES | CCCC#CN1N=C(c2ccc(Cl)cc2)CC(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H19ClN2O/c1-2-3-7-14-24-21(25)19(16-8-5-4-6-9-16)15-20(23-24)17-10-12-18(22)13-11-17/h4-6,8-13,19H,2-3,15H2,1H3 |
| InChIKey | YXGPPTDEYRTDIA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|